(3β)-3-Acetoxylanosta-8,24-dien-21-oic acid structure
|
Common Name | (3β)-3-Acetoxylanosta-8,24-dien-21-oic acid | ||
|---|---|---|---|---|
| CAS Number | 174391-64-1 | Molecular Weight | 498.737 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 577.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C32H50O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4±23.6 °C | |
Use of (3β)-3-Acetoxylanosta-8,24-dien-21-oic acidTsugaric acid A can significantly inhibit superoxide anion formation. Tsugaric acid A also protects human keratinocytes against damage induced by ultraviolet B (UV B) light. Tsugaric acid A can protect keratinocytes from photodamage. |
| Name | Tsugaric acid A |
|---|---|
| Synonym | More Synonyms |
| Description | Tsugaric acid A can significantly inhibit superoxide anion formation. Tsugaric acid A also protects human keratinocytes against damage induced by ultraviolet B (UV B) light. Tsugaric acid A can protect keratinocytes from photodamage. |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 577.3±50.0 °C at 760 mmHg |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.737 |
| Flash Point | 174.4±23.6 °C |
| Exact Mass | 498.370911 |
| PSA | 63.60000 |
| LogP | 9.94 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | FIWGZIBLJWZUEA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC2(C)C3=C(CCC2C1(C)C)C1(C)CCC(C(CCC=C(C)C)C(=O)O)C1(C)CC3 |
| 3alpha-Acetoxylanosta-8,24-dien-21-oic acid |
| Lanosta-8,24-dien-21-oic acid, 3-(acetyloxy)-, (3β)- |
| (3β)-3-Acetoxylanosta-8,24-dien-21-oic acid |
| 3α-Acetoxylanosta-8,24-dien-21-oic acid |
| (3β)-3-(acetyloxy)lanosta-8,24-dien-21-oic acid |