5'-Methylthioadenosine-d3 structure
|
Common Name | 5'-Methylthioadenosine-d3 | ||
|---|---|---|---|---|
| CAS Number | 174838-38-1 | Molecular Weight | 300.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12D3N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-Methylthioadenosine-d35'-Methylthioadenosine-d3 is the deuterium labeled 5'-Methylthioadenosine[1]. 5'-Methylthioadenosine (5'-(Methylthio)-5'-deoxyadenosine) is a nucleoside generated from S-adenosylmethionine (SAM) during polyamine synthesis. 5'-Methylthioadenosine suppresses tumors by inhibiting tumor cell proliferation, invasion, and the induction of apoptosis while controlling the inflammatory micro-environments of tumor tissue. 5'-Methylthioadenosine and its associated materials have striking regulatory effects on tumorigenesis[2][3][4]. |
| Name | 5'-Methylthioadenosine-d3 |
|---|
| Description | 5'-Methylthioadenosine-d3 is the deuterium labeled 5'-Methylthioadenosine[1]. 5'-Methylthioadenosine (5'-(Methylthio)-5'-deoxyadenosine) is a nucleoside generated from S-adenosylmethionine (SAM) during polyamine synthesis. 5'-Methylthioadenosine suppresses tumors by inhibiting tumor cell proliferation, invasion, and the induction of apoptosis while controlling the inflammatory micro-environments of tumor tissue. 5'-Methylthioadenosine and its associated materials have striking regulatory effects on tumorigenesis[2][3][4]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C11H12D3N5O3S |
|---|---|
| Molecular Weight | 300.35 |
| InChIKey | WUUGFSXJNOTRMR-YZLHILBGSA-N |
| SMILES | CSCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |