2-fluoro-6-(4-fluorophenoxy)benzonitrile structure
|
Common Name | 2-fluoro-6-(4-fluorophenoxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 175204-07-6 | Molecular Weight | 231.19800 | |
| Density | 1.31g/cm3 | Boiling Point | 306.3ºC at 760mmHg | |
| Molecular Formula | C13H7F2NO | Melting Point | 73 °C | |
| MSDS | USA | Flash Point | 139ºC | |
| Name | 2-fluoro-6-(4-fluorophenoxy)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 306.3ºC at 760mmHg |
| Melting Point | 73 °C |
| Molecular Formula | C13H7F2NO |
| Molecular Weight | 231.19800 |
| Flash Point | 139ºC |
| Exact Mass | 231.05000 |
| PSA | 33.02000 |
| LogP | 3.62878 |
| Vapour Pressure | 0.000779mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | NOPNZSQHYZPSSX-UHFFFAOYSA-N |
| SMILES | N#Cc1c(F)cccc1Oc1ccc(F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S36/37/39 |
| RIDADR | 3276 |
|
~%
2-fluoro-6-(4-f... CAS#:175204-07-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 51, # 3 p. 449 - 469 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD00068202 |