Benzenepropanoic acid, 3-nitro-b-oxo- structure
|
Common Name | Benzenepropanoic acid, 3-nitro-b-oxo- | ||
|---|---|---|---|---|
| CAS Number | 17589-67-2 | Molecular Weight | 209.15600 | |
| Density | 1.453g/cm3 | Boiling Point | 394.7ºC at 760mmHg | |
| Molecular Formula | C9H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | 3-(3-nitrophenyl)-3-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 394.7ºC at 760mmHg |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.15600 |
| Flash Point | 175.7ºC |
| Exact Mass | 209.03200 |
| PSA | 100.19000 |
| LogP | 1.77540 |
| Vapour Pressure | 6.16E-07mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | SFMZVSSWEAWUFC-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(=O)c1cccc([N+](=O)[O-])c1 |
|
~%
Benzenepropanoi... CAS#:17589-67-2 |
| Literature: Swain,C.G. et al. Journal of the American Chemical Society, 1961 , vol. 83, p. 1951 - 1955 |
|
~%
Benzenepropanoi... CAS#:17589-67-2 |
| Literature: Swain,C.G. et al. Journal of the American Chemical Society, 1961 , vol. 83, p. 1951 - 1955 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenepropanoic acid,3-nitro-b-oxo |
| 3-Nitro-benzoylessigsaeure |