Acetamide,N-(2,6-dichloro-4-nitrophenyl)- structure
|
Common Name | Acetamide,N-(2,6-dichloro-4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 17742-68-6 | Molecular Weight | 249.05100 | |
| Density | 1.573g/cm3 | Boiling Point | 409.2ºC at 760mmHg | |
| Molecular Formula | C8H6Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.3ºC | |
| Name | N-(2,6-dichloro-4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760mmHg |
| Molecular Formula | C8H6Cl2N2O3 |
| Molecular Weight | 249.05100 |
| Flash Point | 201.3ºC |
| Exact Mass | 247.97600 |
| PSA | 74.92000 |
| LogP | 3.45620 |
| Vapour Pressure | 6.63E-07mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | LLGBQJPFOBDFTB-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
Acetamide,N-(2,... CAS#:17742-68-6 |
| Literature: Smith,A.E.; Orton Journal of the Chemical Society, 1908 , vol. 93, p. 1249 |
|
~%
Acetamide,N-(2,... CAS#:17742-68-6 |
| Literature: Witt Chemische Berichte, 1875 , vol. 8, p. 145 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2.6-Dichlor-4-nitro-acetanilid |