(2,3-diphenyl-1-cycloprop-2-enyl) 4-nitrobenzoate structure
|
Common Name | (2,3-diphenyl-1-cycloprop-2-enyl) 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 17825-67-1 | Molecular Weight | 357.35900 | |
| Density | 1.35g/cm3 | Boiling Point | 516.8ºC at 760 mmHg | |
| Molecular Formula | C22H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.7ºC | |
| Name | (2,3-diphenylcycloprop-2-en-1-yl) 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 516.8ºC at 760 mmHg |
| Molecular Formula | C22H15NO4 |
| Molecular Weight | 357.35900 |
| Flash Point | 208.7ºC |
| Exact Mass | 357.10000 |
| PSA | 72.12000 |
| LogP | 5.26800 |
| Vapour Pressure | 8.73E-11mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | QFVHYRHMAAOIST-UHFFFAOYSA-N |
| SMILES | O=C(OC1C(c2ccccc2)=C1c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
(2,3-diphenyl-1... CAS#:17825-67-1 |
| Literature: Jones,W.M. et al. Journal of the American Chemical Society, 1968 , vol. 90, # 7 p. 1849 - 1859 |
|
~%
(2,3-diphenyl-1... CAS#:17825-67-1 |
| Literature: Jones,W.M. et al. Journal of the American Chemical Society, 1968 , vol. 90, # 7 p. 1849 - 1859 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1.2-Diphenyl-cyclopropenyl-(3)-p-nitro-benzoat |
| 2,3-diphenylcycloprop-2-en-1-yl 4-nitrobenzoate |