Methyl 2-hydroxy-3-methoxy-3,3-diphenylpropanoate structure
|
Common Name | Methyl 2-hydroxy-3-methoxy-3,3-diphenylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 178306-47-3 | Molecular Weight | 286.322 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 440.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.4±20.8 °C | |
| Name | methyl 2-hydroxy-3-methoxy-3,3-diphenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.7±40.0 °C at 760 mmHg |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.322 |
| Flash Point | 159.4±20.8 °C |
| Exact Mass | 286.120514 |
| PSA | 55.76000 |
| LogP | 3.99 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | BEPLSLADXOJCBY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(O)C(OC)(c1ccccc1)c1ccccc1 |
| HS Code | 2918990090 |
|---|
|
~96%
Methyl 2-hydrox... CAS#:178306-47-3 |
| Literature: Riechers, Hartmut; Albrecht, Hans-Peter; Amberg, Willi; Baumann, Ernst; Bernard, Harald; Boehm, Hans-Joachim; Klinge, Dagmar; Kling, Andreas; Mueller, Stefan; Raschack, Manfred; Unger, Liliane; Walker, Nigel; Wernet, Wolfgang Journal of Medicinal Chemistry, 1996 , vol. 39, # 11 p. 2123 - 2128 |
|
~%
Methyl 2-hydrox... CAS#:178306-47-3 |
| Literature: US5932730 A1, ; |
|
~%
Methyl 2-hydrox... CAS#:178306-47-3 |
| Literature: US2011/263854 A1, ; Page/Page column 7-8 ; US 20110263854 A1 |
|
~%
Methyl 2-hydrox... CAS#:178306-47-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 39, # 11 p. 2123 - 2128 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2-hydroxy-3-methoxy-3,3-diphenylpropionate |
| methylhydroxymethoxydiphenylpropanoate |
| Methyl 2-hydroxy-3-methoxy-3,3-diphenylpropanoate |
| (S)-2-HYDROXY-3-METHOXY-3,3-DIPHENYLPROPIONIC ACID METHYL ESTER |
| 2-Hydroxy-3-methoxy-3,3-diphenylpropanoic acid methyl ester |
| Benzenepropanoicacid,a-hydroxy-b-methoxy-b-phenyl-,methylester |
| Benzenepropanoic acid, α-hydroxy-β-methoxy-β-phenyl-, methyl ester |
| 2-hydroxy methyl 3-methoxy-3,3-diphenylpropionate |
| 2-hydroxy-3-methoxy-3,3-diphenylpropionicacid methyl ester |