Diethyl 2-((trimethylsilyl)methyl)malonate structure
|
Common Name | Diethyl 2-((trimethylsilyl)methyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 17962-38-8 | Molecular Weight | 246.37500 | |
| Density | 0.973 g/cm3 | Boiling Point | 252.8ºC at 760 mmHg | |
| Molecular Formula | C11H22O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.7ºC | |
| Name | diethyl(trimethylsilylmethyl)malonate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.973 g/cm3 |
|---|---|
| Boiling Point | 252.8ºC at 760 mmHg |
| Molecular Formula | C11H22O4Si |
| Molecular Weight | 246.37500 |
| Flash Point | 88.7ºC |
| Exact Mass | 246.12900 |
| PSA | 52.60000 |
| LogP | 2.06700 |
| Vapour Pressure | 1.45mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | ZEOGFXACYDZIKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C[Si](C)(C)C)C(=O)OCC |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
|
~85%
Diethyl 2-((tri... CAS#:17962-38-8 |
| Literature: Falgner, Steffen; Buchner, Ginka; Tacke, Reinhold Journal of Organometallic Chemistry, 2010 , vol. 695, # 24 p. 2614 - 2617 |
|
~%
Diethyl 2-((tri... CAS#:17962-38-8 |
| Literature: Gmelin Handbook: Si: MVol.C, 7, page 23 - 26 |
|
~%
Diethyl 2-((tri... CAS#:17962-38-8 |
| Literature: Eberson Acta Chemica Scandinavica (1947-1973), 1954 , vol. 8, p. 1183,1184 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trimethylsilylmethyl-malonsaeure-diaethylester |
| diethyl<(trimethylsilyl)methyl>malonate |
| me3Si{et-2-(COOet)2} |
| diethyl 2-((trimethylsilyl)methyl)malonate |
| trimethylsilanylmethyl-malonic acid diethyl ester |
| [(trimethylsilyl)methyl]-propanedioicacidiethylester |
| 2-[(Trimethylsilyl)methyl]propanedioic acid diethyl ester |
| diethyl trimethylsilylcarboxylic acid |