TAMRA-Azide-PEG-Biotin
Modify Date: 2025-08-23 13:51:42
TAMRA-Azide-PEG-Biotin structure
|
Common Name | TAMRA-Azide-PEG-Biotin | ||
|---|---|---|---|---|
| CAS Number | 1797415-74-7 | Molecular Weight | 1174.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C57H79N11O14S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TAMRA-Azide-PEG-BiotinTAMRA-Azide-PEG-biotin is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | TAMRA-Azide-PEG-biotin |
|---|
| Description | TAMRA-Azide-PEG-biotin is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C57H79N11O14S |
|---|---|
| Molecular Weight | 1174.38 |
| InChIKey | OLNZJSRKGRJBHG-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(-c3cc(C(=O)NCCC(=O)N(CCOCCOCCOCCN=[N+]=[N-])CCC(=O)NCCOCCOCCOCCNC(=O)CCCCC4CC5NC(=O)NC5S4)ccc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1.CN(C)c1ccc2c(-c3ccc(C(=O)NCCC(=O)N(CCOCCOCCOCCN=[N+]=[N-])CCC(=O)NCCOCCOCCOCCNC(=O)CCCCC4CC5NC(=O)NC5S4)cc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |