TAMRA-PEG3-Azide structure
|
Common Name | TAMRA-PEG3-Azide | ||
|---|---|---|---|---|
| CAS Number | 1228100-59-1 | Molecular Weight | 646.733 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H38N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TAMRA-PEG3-AzideTAMRA-PEG3-Azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | TAMRA-PEG3-Azide |
|---|---|
| Synonym | More Synonyms |
| Description | TAMRA-PEG3-Azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C33H38N6O7 |
|---|---|
| Molecular Weight | 646.733 |
| Exact Mass | 646.311523 |
| InChIKey | YREJCORUQQJQHB-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCOCCOCCOCCN=[N+]=[N-])cc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| 2-[6-(Dimethylamino)-3-(dimethyliminio)-3H-xanthen-9-yl]benzoate - N-(2-{2-[2-(2-azidoethoxy)ethoxy]ethoxy}ethyl)acetamide (1:1) |
| MFCD28334528 |