Bis-sulfone-PEG3-Azide structure
|
Common Name | Bis-sulfone-PEG3-Azide | ||
|---|---|---|---|---|
| CAS Number | 1802908-01-5 | Molecular Weight | 700.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H40N4O9S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-sulfone-PEG3-AzideBis-sulfone-PEG3-Azide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | Bis-sulfone-PEG3-Azide |
|---|
| Description | Bis-sulfone-PEG3-Azide is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| Molecular Formula | C33H40N4O9S2 |
|---|---|
| Molecular Weight | 700.82 |
| InChIKey | IPFVUCCDSQHREM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(CS(=O)(=O)c2ccc(C)cc2)C(=O)c2ccc(C(=O)NCCOCCOCCOCCN=[N+]=[N-])cc2)cc1 |