Peiminine structure
|
Common Name | Peiminine | ||
|---|---|---|---|---|
| CAS Number | 18059-10-4 | Molecular Weight | 429.635 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 567.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H43NO3 | Melting Point | 212-213ºC | |
| MSDS | N/A | Flash Point | 296.8±30.1 °C | |
Use of PeimininePeiminine(Verticinone; Raddeanine) is a natural compound with anti-inflammatory activity.IC50 value:Target:Peiminine and DXS significantly reduced alveolar inflammation and pulmonary interstitial inflammation in rats with bleomycin-induced lung injury. peiminine inhibits lung inflammation and pulmonary fibrosis in a rat model of bleomycin-induced lung injury, by reducing circulating IFN-γ levels and inhibiting signal transduction pathways involving TGF-β, CTGF, ERK1/2, NF-κB and FasL. |
| Name | Peiminine |
|---|---|
| Synonym | More Synonyms |
| Description | Peiminine(Verticinone; Raddeanine) is a natural compound with anti-inflammatory activity.IC50 value:Target:Peiminine and DXS significantly reduced alveolar inflammation and pulmonary interstitial inflammation in rats with bleomycin-induced lung injury. peiminine inhibits lung inflammation and pulmonary fibrosis in a rat model of bleomycin-induced lung injury, by reducing circulating IFN-γ levels and inhibiting signal transduction pathways involving TGF-β, CTGF, ERK1/2, NF-κB and FasL. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 567.1±50.0 °C at 760 mmHg |
| Melting Point | 212-213ºC |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.635 |
| Flash Point | 296.8±30.1 °C |
| Exact Mass | 429.324280 |
| PSA | 60.77000 |
| LogP | 3.90 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | IQDIERHFZVCNRZ-YUYPDVIUSA-N |
| SMILES | CC1CCC2N(C1)CC1C3CC4C(CC(=O)C5CC(O)CCC54C)C3CCC1C2(C)O |
| Hazard Codes | Xi |
|---|
|
~%
Peiminine CAS#:18059-10-4 |
| Literature: Heterocycles, , vol. 15, # 2 p. 791 - 796 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| MFCD00210542 |
| (3β)-3,20-Dihydroxycevan-6-one |
| Osnovanine |
| Raddeamine |
| (3β,5α)-3,20-Dihydroxycevan-6-one |
| Cevan-6-one, 3,20-dihydroxy-, (3β,5α)- |
| Sipeimine |
| 3beta,20-Dihydroxy-5alpha-cevan-6-one |
| 3β,20-Dihydroxy-5α-cevan-6-one |
| (3b)-3,20-Dihydroxycevan-6-one |
| RADDEANINE |
| Cevan-6-one, 3,20-dihydroxy-, (3β)- |
| cevan-6-one, 3,20-dihydroxy-, (3b)- |
| PEINININE |
| Fritillarine |
| Verticinone |