endo-BCN-PEG3-acid structure
|
Common Name | endo-BCN-PEG3-acid | ||
|---|---|---|---|---|
| CAS Number | 1807501-82-1 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of endo-BCN-PEG3-acidendo-BCN-PEG3-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | endo-BCN-PEG3-acid |
|---|
| Description | endo-BCN-PEG3-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| InChIKey | NRDCHHRLBMBFHZ-UHFFFAOYSA-N |
|---|---|
| SMILES | O=C(O)CCOCCOCCOCCNC(=O)OCC1C2CCC#CCCC21 |