endo-BCN-PEG4-acid structure
|
Common Name | endo-BCN-PEG4-acid | ||
|---|---|---|---|---|
| CAS Number | 1421932-54-8 | Molecular Weight | 441.515 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 608.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H35NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.6±31.5 °C | |
Use of endo-BCN-PEG4-acidendo-BCN-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 1-(Bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azanonadecan-19-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | endo-BCN-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 608.2±55.0 °C at 760 mmHg |
| Molecular Formula | C22H35NO8 |
| Molecular Weight | 441.515 |
| Flash Point | 321.6±31.5 °C |
| Exact Mass | 441.236267 |
| LogP | 0.72 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | MOPSTLKSTPBGBX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)OCC1C2CCC#CCCC21 |
| 2,7,10,13,16-Pentaoxa-4-azanonadecan-19-oic acid, 1-bicyclo[6.1.0]non-4-yn-9-yl-3-oxo- |
| 1-(Bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10,13,16-pentaoxa-4-azanonadecan-19-oic acid |