endo-BCN-PEG2-acid structure
|
Common Name | endo-BCN-PEG2-acid | ||
|---|---|---|---|---|
| CAS Number | 1993134-72-7 | Molecular Weight | 353.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of endo-BCN-PEG2-acidendo-BCN-PEG2-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | endo-BCN-PEG2-acid |
|---|---|
| Synonym | More Synonyms |
| Description | endo-BCN-PEG2-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C18H27NO6 |
|---|---|
| Molecular Weight | 353.41 |
| InChIKey | IAUAMLUNAMJRHF-XYPWUTKMSA-N |
| SMILES | O=C(O)CCOCCOCCNC(=O)OCC1C2CCC#CCCC21 |
| Hazard Codes | Xi |
|---|
| MFCD31692189 |