1,4-Naphthalenedione,2-[3-(4-chlorophenyl)propyl]-3-hydroxy- structure
|
Common Name | 1,4-Naphthalenedione,2-[3-(4-chlorophenyl)propyl]-3-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 18100-12-4 | Molecular Weight | 326.77400 | |
| Density | 1.348g/cm3 | Boiling Point | 506.8ºC at 760mmHg | |
| Molecular Formula | C19H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.3ºC | |
| Name | 3-[3-(4-chlorophenyl)propyl]-4-hydroxynaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 506.8ºC at 760mmHg |
| Molecular Formula | C19H15ClO3 |
| Molecular Weight | 326.77400 |
| Flash Point | 260.3ºC |
| Exact Mass | 326.07100 |
| PSA | 54.37000 |
| LogP | 4.55400 |
| Vapour Pressure | 4.29E-11mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | GISGWVCECYKBPF-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1CCCc1ccc(Cl)cc1 |
|
~%
1,4-Naphthalene... CAS#:18100-12-4 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
|
~%
1,4-Naphthalene... CAS#:18100-12-4 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
|
~%
1,4-Naphthalene... CAS#:18100-12-4 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-[3-(4-chlorophenyl)propyl]-3-hydroxy-1,4-dihydronaphthalene-1,4-dione |
| 2-[3-(4-Chlor-phenyl)-propyl]-3-hydroxy-[1,4]naphthochinon |
| 2-[3-(4-chloro-phenyl)-propyl]-3-hydroxy-[1,4]naphthoquinone |
| 1,4-Naphthalenedione,2-[3-(4-chlorophenyl)propyl]-3-hydroxy |