1,2,4-Naphthalenetriol,1,2,4-triacetate structure
|
Common Name | 1,2,4-Naphthalenetriol,1,2,4-triacetate | ||
|---|---|---|---|---|
| CAS Number | 1785-67-7 | Molecular Weight | 302.27900 | |
| Density | 1.278g/cm3 | Boiling Point | 449.7ºC at 760mmHg | |
| Molecular Formula | C16H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | (3,4-diacetyloxynaphthalen-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 449.7ºC at 760mmHg |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.27900 |
| Flash Point | 200ºC |
| Exact Mass | 302.07900 |
| PSA | 78.90000 |
| LogP | 2.61570 |
| Vapour Pressure | 2.79E-08mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | QJECYGRWVGWSQT-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c2ccccc2c1OC(C)=O |
| HS Code | 2915390090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 1,4-Triacetoxynaphthalene |
| 1,4-Naphthalenetriol,triacetate |
| Naphthalene-1,2,4-triyl triacetate |
| 1,2,4-Triacetoxynaphthalene |
| 1,2,4-Triacetoxy-naphthalin |
| 1,2,4-triacetyloxynaphthalene |