(R)-4-(OXIRAN-2-YLMETHYL)ISOINDOLINE-1,3-DIONE structure
|
Common Name | (R)-4-(OXIRAN-2-YLMETHYL)ISOINDOLINE-1,3-DIONE | ||
|---|---|---|---|---|
| CAS Number | 181140-34-1 | Molecular Weight | 203.194 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 347.4±15.0 °C at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | 101ºC | |
| MSDS | Chinese USA | Flash Point | 163.9±20.4 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | (R)-(-)-Glycidyl phthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.4±15.0 °C at 760 mmHg |
| Melting Point | 101ºC |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.194 |
| Flash Point | 163.9±20.4 °C |
| Exact Mass | 203.058243 |
| PSA | 58.70000 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | DUILGEYLVHGSEE-SSDOTTSWSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC1CO1 |
|
~84%
(R)-4-(OXIRAN-2... CAS#:181140-34-1 |
| Literature: Gutcait, Alexander; Wang, Kuang-Chao; Liu, Hsiu-Wen; Chern, Ji-Wang Tetrahedron Asymmetry, 1996 , vol. 7, # 6 p. 1641 - 1648 |
|
~72%
(R)-4-(OXIRAN-2... CAS#:181140-34-1 |
| Literature: DAISO CO., LTD. Patent: EP1403267 A1, 2004 ; Location in patent: Page 6 ; |
|
~90%
(R)-4-(OXIRAN-2... CAS#:181140-34-1 |
| Literature: Miki, Yasushi; Mikami, Masafumi Patent: US2006/19993 A1, 2006 ; Location in patent: Page/Page column 5 ; |
|
~72%
(R)-4-(OXIRAN-2... CAS#:181140-34-1 |
| Literature: DAISO CO., LTD. Patent: EP1403267 A1, 2004 ; Location in patent: Page 5 ; |
|
~%
(R)-4-(OXIRAN-2... CAS#:181140-34-1 |
| Literature: EP1403267 A1, ; Page 6 ; |
|
~91%
(R)-4-(OXIRAN-2... CAS#:181140-34-1 |
| Literature: KANEKA CORPORATION Patent: EP1553093 A1, 2005 ; Location in patent: Page/Page column 24 ; |
|
~84%
(R)-4-(OXIRAN-2... CAS#:181140-34-1 |
| Literature: DAISO CO., LTD. Patent: EP1403267 A1, 2004 ; Location in patent: Page 6-7 ; |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H-Isoindole-1,3(2H)-dione, 2-[(2S)-oxiranylmethyl]- |
| 2-[(2S)-Oxiran-2-ylmethyl]-1H-isoindole-1,3(2H)-dione |
| (R)-N-Glycidylphthalimide |
| (R)-N-(2,3-Epoxypropyl)phthalimide |
| 2-[(2R)-Oxiran-2-ylmethyl]-1H-isoindole-1,3(2H)-dione |
| 2-[(2S)-2-Oxiranylmethyl]-1H-isoindole-1,3(2H)-dione |
| N-(R)-Glycidyl Phthalimide |
| 2-[(2R)-2-Oxiranylmethyl]-1H-isoindole-1,3(2H)-dione |
| (R)-4-(Oxiran-2-ylmethyl)isoindoline-1,3-dione |
| MFCD04973349 |
| 1H-Isoindole-1,3(2H)-dione, 2-[(2R)-oxiranylmethyl]- |