Acolbifene structure
|
Common Name | Acolbifene | ||
|---|---|---|---|---|
| CAS Number | 182167-02-8 | Molecular Weight | 457.56 | |
| Density | N/A | Boiling Point | 651.5ºC at 760mmHg | |
| Molecular Formula | C29H31NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.8ºC | |
Use of AcolbifeneAcolbifene (EM652) is a fourth-generation selective estrogen receptor antagonist with a LC50 value of 22±3 nM. |
| Name | (2S)-3-(4-Hydroxyphenyl)-4-methyl-2-{4-[2-(1-piperidinyl)ethoxy]p henyl}-2H-chromen-7-ol hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Description | Acolbifene (EM652) is a fourth-generation selective estrogen receptor antagonist with a LC50 value of 22±3 nM. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 651.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.56 |
| Flash Point | 347.8ºC |
| PSA | 62.16000 |
| LogP | 6.76680 |
| InChIKey | DUYNJNWVGIWJRI-LJAQVGFWSA-N |
| SMILES | CC1=C(c2ccc(O)cc2)C(c2ccc(OCCN3CCCCC3)cc2)Oc2cc(O)ccc21 |
| (S)-3-(4-carboxybenzyl)willardiine |
| (aS)-a-Amino-3-((4-carboxyphenyl)methyl)-3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinepropanoicacid |
| (S)-3-(4-hydroxyphenyl)-4-methyl-2-[4-[2-(1-piperidinyl)ethoxy]phenyl]-2H-1-benzopyran-7-ol |
| UBP 282 |