pentachloroanisole structure
|
Common Name | pentachloroanisole | ||
|---|---|---|---|---|
| CAS Number | 1825-21-4 | Molecular Weight | 280.36300 | |
| Density | 1.618g/cm3 | Boiling Point | 321.5ºC at 760mmHg | |
| Molecular Formula | C7H3Cl5O | Melting Point | 108-110℃ | |
| MSDS | Chinese USA | Flash Point | 127.1ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 1,2,3,4,5-pentachloro-6-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.618g/cm3 |
|---|---|
| Boiling Point | 321.5ºC at 760mmHg |
| Melting Point | 108-110℃ |
| Molecular Formula | C7H3Cl5O |
| Molecular Weight | 280.36300 |
| Flash Point | 127.1ºC |
| Exact Mass | 277.86300 |
| PSA | 9.23000 |
| LogP | 4.96220 |
| Vapour Pressure | 0.000557mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | BBABSCYTNHOKOG-UHFFFAOYSA-N |
| SMILES | COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H400 |
| Precautionary Statements | P273 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | UN 2811 |
| WGK Germany | 3.0 |
| RTECS | BZ8820000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2909309090 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Responses of the L5178Y tk+/tk- mouse lymphoma cell forward mutation assay to coded chemicals. I: Results for nine compounds.
Environ. Mutagen. 9(2) , 143-60, (1987) Nine substances were tested for their mutagenic potential in the L5178Y tk+/tk- mouse lymphoma cell forward mutation assay, by means of procedures based upon those described by Clive and Spector (Muta... |
|
|
Involvement of cytochrome P450 in pentachlorophenol transformation in a white rot fungus Phanerochaete chrysosporium.
PLoS ONE 7(9) , e45887, (2012) The occurrence of cytochrome P450 and P450-mediated pentachlorophenol oxidation in a white rot fungus Phanerochaete chrysosporium was demonstrated in this study. The carbon monoxide difference spectra... |
|
|
Determination of halophenolic wood preservant traces in milk using headspace solid-phase microextraction and gas chromatography-mass spectrometry.
J. Chromatogr. A. 1215(1-2) , 1-7, (2008) Extraction of 2,4,6-tribromophenol (TBP), pentachlorophenol (PCP) and pentachloroanisole (PCA) from whole fat cow milk using headspace solid-phase microextraction (HS-SPME) with polyacrylate (PA) and ... |
| Methyl pentachlorophenyl ether |
| 2,3,4,5,6-pentachloroanisole |
| pentachlorophenol anisole |
| Ether,methyl pentachlorophenyl |
| Pentachloromethoxybenzene |
| Methyl pentachlorophenate |
| Benzene,pentachloromethoxy |
| Anisole,2,3,4,5,6-pentachloro |
| Pentachlorophenyl methyl ether |
| Pentachloranisole |
| Methyl pentachlorophenyl ester |
| pentachloroanisol |
| Pentachloroanisole |