4-Bromo-5-methyl-2-nitrophenol structure
|
Common Name | 4-Bromo-5-methyl-2-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 182500-28-3 | Molecular Weight | 232.03100 | |
| Density | 1.756g/cm3 | Boiling Point | 292.556ºC at 760 mmHg | |
| Molecular Formula | C7H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.733ºC | |
| Name | 4-Bromo-5-methyl-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.756g/cm3 |
|---|---|
| Boiling Point | 292.556ºC at 760 mmHg |
| Molecular Formula | C7H6BrNO3 |
| Molecular Weight | 232.03100 |
| Flash Point | 130.733ºC |
| Exact Mass | 230.95300 |
| PSA | 66.05000 |
| LogP | 2.89450 |
| Vapour Pressure | 0.001mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | DNYRLBZBDGVLHF-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c([N+](=O)[O-])cc1Br |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-Brom-5-methyl-2-nitro-phenol |
| 4-bromo-5-methyl-2-nitro-phenol |
| 4-Brom-6-nitro-m-kresol |
| 6-Brom-4-nitro-3-oxy-toluol |
| 6-bromo-3-hydroxy-4-nitro toluene |
| 4-Brom-3-hydroxy-6-nitro-toluol |