Azido-PEG4-(CH2)3-methyl ester
Modify Date: 2025-09-29 18:45:25
Azido-PEG4-(CH2)3-methyl ester structure
|
Common Name | Azido-PEG4-(CH2)3-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1835759-71-1 | Molecular Weight | 319.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG4-(CH2)3-methyl esterAzido-PEG4-(CH2)3-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG4-(CH2)3-methyl ester |
|---|
| Description | Azido-PEG4-(CH2)3-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C13H25N3O6 |
|---|---|
| Molecular Weight | 319.35 |
| InChIKey | PZVGELSZWFBVCY-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCOCCOCCOCCOCCN=[N+]=[N-] |