FAAH-IN-2 structure
|
Common Name | FAAH-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 184475-71-6 | Molecular Weight | 319.718 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 478.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H11ClFN3O2 | Melting Point | >260ºC (dec.) | |
| MSDS | N/A | Flash Point | 243.4±28.7 °C | |
Use of FAAH-IN-2FAAH-IN-2 is a potent FAAH(fatty acid amide hydrolase) inhibitor extracted from Patent WO/2008/100977A2. |
| Name | O-Desmorpholinopropyl Gefitinib |
|---|---|
| Synonym | More Synonyms |
| Description | FAAH-IN-2 is a potent FAAH(fatty acid amide hydrolase) inhibitor extracted from Patent WO/2008/100977A2. |
|---|---|
| Related Catalog |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.8±45.0 °C at 760 mmHg |
| Melting Point | >260ºC (dec.) |
| Molecular Formula | C15H11ClFN3O2 |
| Molecular Weight | 319.718 |
| Flash Point | 243.4±28.7 °C |
| Exact Mass | 319.052368 |
| PSA | 67.27000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | JLVTVCRXFMLUIF-UHFFFAOYSA-N |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[(3-Chloro-4-fluorophenyl)amino]-7-methoxy-6-quinazolinol |
| 6-Quinazolinol, 4-[(3-chloro-4-fluorophenyl)amino]-7-methoxy- |
| 4-[(3-chloro-4-fluorophenyl)amino]-7-methoxyquinazolin-6-ol |
| 4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-ol |
| 4-(3-chloro-4-fluorophenylamino)-7-methoxy quinazolin-6-ol |
| Gefitinib Impurity 2 |
| FAAH-IN-2 |