Heat Shock Protein Inhibitor II structure
|
Common Name | Heat Shock Protein Inhibitor II | ||
|---|---|---|---|---|
| CAS Number | 1859-42-3 | Molecular Weight | 217.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Heat Shock Protein Inhibitor IIKNK423 is a specific heat shock protein (HSP) synthesis inhibitor. KNK423 improves the efficiency of Amphotericin B in inhibiting resistant Aspergillus terreus by blocking HSP70. KNK423 can be used in cancer and bacterial infection research[1][2]. |
| Name | 3-benzo[1,3]dioxol-5-ylmethylene-pyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | KNK423 is a specific heat shock protein (HSP) synthesis inhibitor. KNK423 improves the efficiency of Amphotericin B in inhibiting resistant Aspergillus terreus by blocking HSP70. KNK423 can be used in cancer and bacterial infection research[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H11NO3 |
|---|---|
| Molecular Weight | 217.22 |
| Exact Mass | 217.07400 |
| PSA | 47.56000 |
| LogP | 1.64740 |
| InChIKey | IJPPHWXYOJXQMV-WEVVVXLNSA-N |
| SMILES | O=C1NCCC1=Cc1ccc2c(c1)OCO2 |
| 2-oxo-3-piperonyliden-pyrrolidin |
| HEAT SHOCK PROTEIN INHIBITOR II |
| 3,4-methylenedioxy-benzylidine-γ-butyrolactam |