TETRABUTYLAMMONIUM BENZOATE structure
|
Common Name | TETRABUTYLAMMONIUM BENZOATE | ||
|---|---|---|---|---|
| CAS Number | 18819-89-1 | Molecular Weight | 363.57700 | |
| Density | 1.33g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C23H41NO2 | Melting Point | 64-67ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 148.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tetrabutylazanium,benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Melting Point | 64-67ºC(lit.) |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.57700 |
| Flash Point | 148.7ºC |
| Exact Mass | 363.31400 |
| PSA | 40.13000 |
| LogP | 5.05370 |
| Vapour Pressure | 5.03E-09mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | WGYONVRJGWHMKV-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=C([O-])c1ccccc1 |
| Water Solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2923900090 |
|
~%
TETRABUTYLAMMON... CAS#:18819-89-1 |
| Literature: Organic and Biomolecular Chemistry, , vol. 9, # 23 p. 8122 - 8129 |
|
~72%
TETRABUTYLAMMON... CAS#:18819-89-1 |
| Literature: Zhang, Yong-Min; Mallet, Jean-Maurice; Sinay, Pierre Carbohydrate Research, 1992 , vol. 236, p. 73 - 88 |
|
~%
TETRABUTYLAMMON... CAS#:18819-89-1 |
| Literature: Botta; De Angelis; Grgurina; et al. Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 4 p. 1001 - 1007 |
|
~%
TETRABUTYLAMMON... CAS#:18819-89-1 |
| Literature: Chemical Communications, , # 28 p. 4299 - 4301 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| tetra-n-butylammonium Benzoate |
| MFCD00171701 |
| Tetrabutylammonium benzoate |