S1P1 agonist 4 structure
|
Common Name | S1P1 agonist 4 | ||
|---|---|---|---|---|
| CAS Number | 1883345-11-6 | Molecular Weight | 381.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of S1P1 agonist 4S1P1 agonist 4 has a better profile in both potency (EC50 < 0.05 mg/kg) and predicted human half-life (t1/2 ∼ 5 days). |
| Name | S1P1 agonist 4 |
|---|
| Description | S1P1 agonist 4 has a better profile in both potency (EC50 < 0.05 mg/kg) and predicted human half-life (t1/2 ∼ 5 days). |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H31NO3 |
|---|---|
| Molecular Weight | 381.51 |
| InChIKey | ULPUUXGQQJQWLG-QATBIIFWSA-N |
| SMILES | COc1cccc(OCC2CCc3cc(C4CCC(N)(CO)C4)ccc3C2)c1 |