2-bromo-3-(2-nitrophenyl)propanoic acid structure
|
Common Name | 2-bromo-3-(2-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 18910-10-6 | Molecular Weight | 274.06800 | |
| Density | 1.726g/cm3 | Boiling Point | 377ºC at 760 mmHg | |
| Molecular Formula | C9H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | 2-bromo-3-(2-nitrophenyl)propanoic acid |
|---|
| Density | 1.726g/cm3 |
|---|---|
| Boiling Point | 377ºC at 760 mmHg |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | 274.06800 |
| Flash Point | 181.8ºC |
| Exact Mass | 272.96400 |
| PSA | 83.12000 |
| LogP | 2.50860 |
| Vapour Pressure | 2.36E-06mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | FLIANSUSPPFEAK-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Br)Cc1ccccc1[N+](=O)[O-] |
|
~%
2-bromo-3-(2-ni... CAS#:18910-10-6 |
| Literature: Jaenisch Chemische Berichte, 1923 , vol. 56, p. 2450 |
|
~%
2-bromo-3-(2-ni... CAS#:18910-10-6 |
| Literature: Jaenisch Chemische Berichte, 1923 , vol. 56, p. 2450 |
|
~%
2-bromo-3-(2-ni... CAS#:18910-10-6 |
| Literature: Jaenisch Chemische Berichte, 1923 , vol. 56, p. 2450 |
|
~%
2-bromo-3-(2-ni... CAS#:18910-10-6 |
| Literature: McCord; DuBose; Shafer; Davis Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 3 p. 643 - 646 |
|
~%
2-bromo-3-(2-ni... CAS#:18910-10-6 |
| Literature: Jaenisch Chemische Berichte, 1923 , vol. 56, p. 2450 |
|
~%
2-bromo-3-(2-ni... CAS#:18910-10-6 |
| Literature: Jaenisch Chemische Berichte, 1923 , vol. 56, p. 2450 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |