ANP-Linker structure
|
Common Name | ANP-Linker | ||
|---|---|---|---|---|
| CAS Number | 171778-06-6 | Molecular Weight | 432.42500 | |
| Density | 1.37g/cm3 | Boiling Point | 695.5ºC at 760 mmHg | |
| Molecular Formula | C24H20N2O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 374.4ºC | |
| Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 695.5ºC at 760 mmHg |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.42500 |
| Flash Point | 374.4ºC |
| Exact Mass | 432.13200 |
| PSA | 121.45000 |
| LogP | 5.56340 |
| Vapour Pressure | 2.63E-20mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | DRESTDPDCGPKNI-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccccc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
|
~97%
ANP-Linker CAS#:171778-06-6 |
| Literature: Li, Haishan; Hah, Jung-Mi; Lawrence, David S. Journal of the American Chemical Society, 2008 , vol. 130, # 32 p. 10474 - 10475 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Fmoc-ANP-OH |
| AmbotzRL-1113 |