DS-1001b
Modify Date: 2025-08-27 15:52:06
DS-1001b structure
|
Common Name | DS-1001b | ||
|---|---|---|---|---|
| CAS Number | 1898207-64-1 | Molecular Weight | 608.92 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H29Cl3FN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DS-1001bDS-1001b is a mutant IDH-1 (Isocitrate Dehydrogenase-1) inhibitor extracted from patent WO2016052697A1, Example 168, and has antitumor activity[1]. |
| Name | DS-1001b |
|---|
| Description | DS-1001b is a mutant IDH-1 (Isocitrate Dehydrogenase-1) inhibitor extracted from patent WO2016052697A1, Example 168, and has antitumor activity[1]. |
|---|---|
| Related Catalog | |
| Target |
IDH-1[1] |
| References |
| Molecular Formula | C29H29Cl3FN3O4 |
|---|---|
| Molecular Weight | 608.92 |
| InChIKey | UPPAAWQBZQBNIE-USRGLUTNSA-N |
| SMILES | CC(C)(C)N.Cc1cn(C(=O)c2c(-c3c(Cl)cc(Cl)cc3Cl)noc2C(C)(C)F)c2cccc(C=CC(=O)O)c12 |