bis(4-methylphenyl)iodanium,chloride structure
|
Common Name | bis(4-methylphenyl)iodanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 19028-28-5 | Molecular Weight | 344.61800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClI | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-methylphenyl)iodanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14ClI |
|---|---|
| Molecular Weight | 344.61800 |
| Exact Mass | 343.98300 |
| InChIKey | SRMQETMVLPPTFX-UHFFFAOYSA-M |
| SMILES | Cc1ccc([I+]c2ccc(C)cc2)cc1.[Cl-] |
|
~46%
bis(4-methylphe... CAS#:19028-28-5 |
| Literature: San-Apro Limited Patent: EP1752463 A1, 2007 ; Location in patent: Page/Page column 20-21 ; |
|
~%
bis(4-methylphe... CAS#:19028-28-5 |
| Literature: Beringer et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 342,347 |
| di-p-tolyl-iodonium,chloride |
| Toliodium chloride |
| 4,4'-Dimethyl-diphenyl-jodonium-chlorid |
| Di-p-tolyl-jodonium-chlorid |