Prosapogenin A structure
|
Common Name | Prosapogenin A | ||
|---|---|---|---|---|
| CAS Number | 19057-67-1 | Molecular Weight | 722.902 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 838.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C39H62O12 | Melting Point | 212℃ | |
| MSDS | N/A | Flash Point | 461.1±34.3 °C | |
Use of Prosapogenin AProsapogenin A, a natural product from Veratrum, induces apoptosis in human cancer cells in vitro via inhibition of the STAT3 signaling pathway and glycolysis[1]. |
| Name | ProsapogeninANLG of diocin |
|---|---|
| Synonym | More Synonyms |
| Description | Prosapogenin A, a natural product from Veratrum, induces apoptosis in human cancer cells in vitro via inhibition of the STAT3 signaling pathway and glycolysis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 838.8±65.0 °C at 760 mmHg |
| Melting Point | 212℃ |
| Molecular Formula | C39H62O12 |
| Molecular Weight | 722.902 |
| Flash Point | 461.1±34.3 °C |
| Exact Mass | 722.424133 |
| PSA | 176.76000 |
| LogP | 6.90 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | HDXIQHTUNGFJIC-FOAHKCLGSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CC=C5CC(OC6OC(CO)C(O)C(O)C6OC6OC(C)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C1C2C |
| Hazard Codes | Xi |
|---|
| Prosapogenin A |
| (3β,25R)-Spirost-5-en-3-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| β-D-Glucopyranoside, (3β,25R)-spirost-5-en-3-yl 2-O-(6-deoxy-α-L-mannopyranosyl)- |
| polyphyllin V |
| Progenin III |