2-Propen-1-one,3-ethoxy-1,3-diphenyl- structure
|
Common Name | 2-Propen-1-one,3-ethoxy-1,3-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 1907-69-3 | Molecular Weight | 252.30800 | |
| Density | 1.084g/cm3 | Boiling Point | 380.5ºC at 760mmHg | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethoxy-1,3-diphenyl-prop-2-en-1-one |
|---|
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 380.5ºC at 760mmHg |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.30800 |
| Exact Mass | 252.11500 |
| PSA | 26.30000 |
| LogP | 3.94690 |
| Vapour Pressure | 5.42E-06mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | GMWQGXUAHMDHHZ-LGMDPLHJSA-N |
| SMILES | CCOC(=CC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2914509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |