1,3-Propanedione,2-bromo-1,3-diphenyl structure
|
Common Name | 1,3-Propanedione,2-bromo-1,3-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 728-84-7 | Molecular Weight | 303.15100 | |
| Density | 1.44g/cm3 | Boiling Point | 403.4ºC at 760 mmHg | |
| Molecular Formula | C15H11BrO2 | Melting Point | 89-93ºC | |
| MSDS | USA | Flash Point | 114.5ºC | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | 2-Bromo-1,3-diphenylpropane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 403.4ºC at 760 mmHg |
| Melting Point | 89-93ºC |
| Molecular Formula | C15H11BrO2 |
| Molecular Weight | 303.15100 |
| Flash Point | 114.5ºC |
| Exact Mass | 301.99400 |
| PSA | 34.14000 |
| LogP | 3.51570 |
| Index of Refraction | 1.616 |
| InChIKey | BYAJHZYXPBREEK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Br)C(=O)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | 22-36/37/38-50 |
| RIDADR | UN 3077 9/PG 3 |
| RTECS | TZ1925000 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2-bromo-1,3-diphenyldiketone |
| 1,3-PROPANEDIONE,2-BROMO-1,3-DIPHENYL |
| 2-Bromo-1,3-diphenyl-propane-1,3-dione |
| Bromodibenzoylmethane |
| Methane,dibenzoylbromo |
| 2-bromo-1,3-diphenylpropan-1,3-dione |
| 2-bromodibenzoylmethane |
| PhCOCHBrCOPh |
| 1,3-diphenyl-2-bromopropane-1,3-dione |
| Dibenzoylbromomethane |
| 2-Bromo-1,3-diphenyl-1,3-propanedione |