Aminooxy-PEG5-azide structure
|
Common Name | Aminooxy-PEG5-azide | ||
|---|---|---|---|---|
| CAS Number | 1919045-02-5 | Molecular Weight | 322.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Aminooxy-PEG5-azideAminooxy-PEG5-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | Aminooxy-PEG5-azide |
|---|
| Description | Aminooxy-PEG5-azide is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H26N4O6 |
|---|---|
| Molecular Weight | 322.36 |
| InChIKey | TZMRTDAQRAJMRO-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCON |
| Storage condition | 2-8°C |