9,10-Anthracenedione,1-hydroxy-4-(phenylamino)
Modify Date: 2025-08-23 13:04:24
9,10-Anthracenedione,1-hydroxy-4-(phenylamino) structure
|
Common Name | 9,10-Anthracenedione,1-hydroxy-4-(phenylamino) | ||
|---|---|---|---|---|
| CAS Number | 19286-75-0 | Molecular Weight | 315.32200 | |
| Density | 1.41g/cm3 | Boiling Point | 507.2ºC at 760mmHg | |
| Molecular Formula | C20H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.5ºC | |
| Name | 1-anilino-4-hydroxyanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 507.2ºC at 760mmHg |
| Molecular Formula | C20H13NO3 |
| Molecular Weight | 315.32200 |
| Flash Point | 260.5ºC |
| Exact Mass | 315.09000 |
| PSA | 66.40000 |
| LogP | 3.98420 |
| InChIKey | ZNQIAQXHADXXQI-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(Nc3ccccc3)ccc(O)c21 |
| HS Code | 2922509090 |
|---|
|
~%
9,10-Anthracene... CAS#:19286-75-0 |
| Literature: Grandmougin Journal fuer Praktische Chemie (Leipzig), 1907 , vol. <2> 76, p. 140 Chem. Zentralbl., 1908 , vol. 79, # I p. 2178 |
|
~%
9,10-Anthracene... CAS#:19286-75-0 |
| Literature: Ullmann; Conzetti Chemische Berichte, 1920 , vol. 53, p. 836 |
|
~%
9,10-Anthracene... CAS#:19286-75-0 |
| Literature: Ullmann; Conzetti Chemische Berichte, 1920 , vol. 53, p. 836 |
|
~%
9,10-Anthracene... CAS#:19286-75-0 |
| Literature: Ullmann; Conzetti Chemische Berichte, 1920 , vol. 53, p. 836 |
CAS#:81386-51-8| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-anilino-4-hydroxy-anthraquinone |
| C.I.Disperse Violet 30 |
| DISPERSEVIOLET23.27 |
| Sumikaron Violet E-RL |
| 4-phenylamino-1-hydroxy-9,10-anthraquinone |
| Latyl Violet BN |
| Sumikaron Violet RL |
| 1-hydroxy-4-(phenylamino)-Anthraquinone |
| C.I.DISPERSEVIOLET27 |
| 1-hydroxy-4-phenylamino-9,10-anthraquinone |
| 1-phenylamino-4-hydroxyanthraquinone |