9,10-Anthracenedione,1-chloro-4-hydroxy structure
|
Common Name | 9,10-Anthracenedione,1-chloro-4-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 82-42-8 | Molecular Weight | 258.65700 | |
| Density | 1.526g/cm3 | Boiling Point | 468.3ºC at 760 mmHg | |
| Molecular Formula | C14H7ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | 1-chloro-4-hydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 468.3ºC at 760 mmHg |
| Molecular Formula | C14H7ClO3 |
| Molecular Weight | 258.65700 |
| Flash Point | 237ºC |
| Exact Mass | 258.00800 |
| PSA | 54.37000 |
| LogP | 2.82100 |
| Index of Refraction | 1.699 |
| InChIKey | TUZZWPYZPHNFJY-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(Cl)ccc(O)c21 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| UNII-50T4JF2H1K |
| 1-hydroxy-4-chloroanthraquinone |
| 1-Chloro-4-hydroxyanthraquinone |
| 1-hydroxy-4-chloro-9,10-anthraquinone |
| 9,10-Anthracenedione,1-chloro-4-hydroxy |
| 1-hydroxy-4-chloro-anthracene-9,10-dione |
| 1-Chlor-4-hydroxy-anthrachinon |
| Anthraquinone,1-chloro-4-hydroxy |
| 4-chloro-1-hydroxyanthraquinone |
| 9,1-chloro-4-hydroxy |