1,3-Propylenediaminetertaacetic acid structure
|
Common Name | 1,3-Propylenediaminetertaacetic acid | ||
|---|---|---|---|---|
| CAS Number | 1939-36-2 | Molecular Weight | 306.26900 | |
| Density | 1.507g/cm3 | Boiling Point | 620.5ºC at 760mmHg | |
| Molecular Formula | C11H18N2O8 | Melting Point | ~250 °C (dec.) | |
| MSDS | N/A | Flash Point | 329.1ºC | |
| Name | 2-[3-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 620.5ºC at 760mmHg |
| Melting Point | ~250 °C (dec.) |
| Molecular Formula | C11H18N2O8 |
| Molecular Weight | 306.26900 |
| Flash Point | 329.1ºC |
| Exact Mass | 306.10600 |
| PSA | 155.68000 |
| Vapour Pressure | 5.42E-17mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | DMQQXDPCRUGSQB-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CCCN(CC(=O)O)CC(=O)O)CC(=O)O |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
|---|---|
| Risk Phrases | R22;R41;R50/53 |
| Safety Phrases | S22-S26-S39-S60-S61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | MC1082500 |
| HS Code | 2922499990 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD00210039 |
| propylenedinitrilotetraacetic acid |
| 1,3-Diaminopropane-N,N,N',N'-tetraacetic acid |
| N-[(3-[bis(carboxymethyl)amino]propyl)-N-(carboxymethyl)]aminoacetic acid |
| Glycine,N,N'-1,3-propanediylbis(N-(carboxymethyl) |
| 1,3-PropanediaMine-N,N,N',N'-tetraacetic Acid |
| 1,3-Propylenediaminetertaacetic acid |
| EINECS 400-400-9 |
| 1,3-PROPYLENEDIAMINETETRAACETIC ACID |
| 400-400-9[elincs] |
| trimethylenediamine-N,N,N',N'-tetraacetic acid |
| trimethyelenediamine-N,N,N',N'-tetraacetic acid |
| trimethylenediamino-N,N,N',N'-tetraacetic acid |
| Acetic acid,(trimethylenedinitrilo)tetra |