2-acetamido-6-chlorobenzoic acid structure
|
Common Name | 2-acetamido-6-chlorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 19407-42-2 | Molecular Weight | 213.61800 | |
| Density | 1.453g/cm3 | Boiling Point | 429.5ºC at 760mmHg | |
| Molecular Formula | C9H8ClNO3 | Melting Point | 216-218°C | |
| MSDS | USA | Flash Point | 213.5ºC | |
| Name | 2-acetamido-6-chlorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 429.5ºC at 760mmHg |
| Melting Point | 216-218°C |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.61800 |
| Flash Point | 213.5ºC |
| Exact Mass | 213.01900 |
| PSA | 66.40000 |
| LogP | 2.06960 |
| Vapour Pressure | 3.87E-08mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | VFHSJTHAMJFUCK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(Cl)c1C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2924299090 |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Chlor-2-acetamino-benzoesaeure |
| MFCD00051939 |
| 2-chloro-6-acetamidobenzoic acid |
| N-Acetyl-6-chlor-anthranilsaeure |
| EINECS 243-040-6 |
| 2-Acetylamino-6-chlor-benzoesaeure |