2-Acetamido-6-nitrobenzoic acid structure
|
Common Name | 2-Acetamido-6-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 73721-78-5 | Molecular Weight | 224.170 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 472.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H8N2O5 | Melting Point | 214 °C(dec.) | |
| MSDS | N/A | Flash Point | 239.4±27.3 °C | |
| Name | 2-Carboxy-3-Nitroacetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.2±40.0 °C at 760 mmHg |
| Melting Point | 214 °C(dec.) |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.170 |
| Flash Point | 239.4±27.3 °C |
| Exact Mass | 224.043320 |
| PSA | 112.22000 |
| LogP | 2.20 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | HHNTZMHFBQIQAK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc([N+](=O)[O-])c1C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
2-Acetamido-6-n... CAS#:73721-78-5 |
| Literature: Journal of the American Chemical Society, , vol. 27, p. 653 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(Acetylamino)-6-nitrobenzoic Acid |
| 2-Acetamido-6-nitrobenzoic acid |
| Benzoic acid, 2-(acetylamino)-6-nitro- |