2,4'-Dichlorobenzophenone structure
|
Common Name | 2,4'-Dichlorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 19811-05-3 | Molecular Weight | 251.108 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 366.1±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H8Cl2O | Melting Point | 47°C | |
| MSDS | N/A | Flash Point | 154.8±24.3 °C | |
| Name | (2,4-dichlorophenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.1±27.0 °C at 760 mmHg |
| Melting Point | 47°C |
| Molecular Formula | C13H8Cl2O |
| Molecular Weight | 251.108 |
| Flash Point | 154.8±24.3 °C |
| Exact Mass | 249.995224 |
| PSA | 17.07000 |
| LogP | 4.09 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | VLTYTTRXESKBKI-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(Cl)cc1Cl |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Methanone, (2,4-dichlorophenyl)phenyl- |
| 2,4-DICHLOROBENZOPHENONE |
| 2,4,5-TRIMETHYLRESORCINOL |
| MFCD00018374 |
| 2,4-Dichlor-benzophenon |
| (2-Chlorophenyl)(4-chlorophenyl)methanone |
| Phenyl-(2.4-dichlor-phenyl)-keton |
| Methanone, (2-chlorophenyl)(4-chlorophenyl)- |
| 4-Dichloro Benzophenone |
| EINECS 243-338-6 |
| acetophenone |
| (2,4-Dichlorophenyl)(phenyl)methanone |
| 2,4'-Dichlorobenzophenone |