4-AMINO-N-(3-CHLORO-PHENYL)-BENZENESULFONAMIDE structure
|
Common Name | 4-AMINO-N-(3-CHLORO-PHENYL)-BENZENESULFONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 19837-81-1 | Molecular Weight | 282.74600 | |
| Density | 1.466 g/cm3 | Boiling Point | 467ºC at 760 mmHg | |
| Molecular Formula | C12H11ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | 4-amino-N-(3-chlorophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466 g/cm3 |
|---|---|
| Boiling Point | 467ºC at 760 mmHg |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.74600 |
| Flash Point | 236.3ºC |
| Exact Mass | 282.02300 |
| PSA | 80.57000 |
| LogP | 4.45800 |
| Vapour Pressure | 6.73E-09mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | ZVOMLEQGMOLOEM-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)Nc2cccc(Cl)c2)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
4-AMINO-N-(3-CH... CAS#:19837-81-1 |
| Literature: Chemische Berichte, , vol. 81, p. 297,302 |
|
~%
4-AMINO-N-(3-CH... CAS#:19837-81-1 |
| Literature: Chemische Berichte, , vol. 81, p. 297,302 |
|
~93%
4-AMINO-N-(3-CH... CAS#:19837-81-1 |
| Literature: Zheng, Xiaoxia; Oda, Hiroyuki; Takamatsu, Kayo; Sugimoto, Yukio; Tai, Akihiro; Akaho, Eiichi; Ali, Hamed Ismail; Oshiki, Toshiyuki; Kakuta, Hiroki; Sasaki, Kenji Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 2 p. 1014 - 1021 |
|
~%
4-AMINO-N-(3-CH... CAS#:19837-81-1 |
| Literature: Chemische Berichte, , vol. 81, p. 297,302 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Sulfanilsaeure-(3-chlor-anilid) |
| 4-Amino-N-(3-chloro-phenyl)-benzenesulfonamide |
| sulfanilic acid-(3-chloro-anilide) |
| N(1)-(3'-Chlor-phenyl)-sulfanilamid |
| N1-(m-Chlor-phenyl)-sulfanilamid |