5-(2-nitrophenyl)-2-furaldehyde structure
|
Common Name | 5-(2-nitrophenyl)-2-furaldehyde | ||
|---|---|---|---|---|
| CAS Number | 20000-96-8 | Molecular Weight | 217.17800 | |
| Density | 1.348 g/cm3 | Boiling Point | 105-107 °C30 mm Hg(lit.) | |
| Molecular Formula | C11H7NO4 | Melting Point | 94-97 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 189.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(2-nitrophenyl)furan-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348 g/cm3 |
|---|---|
| Boiling Point | 105-107 °C30 mm Hg(lit.) |
| Melting Point | 94-97 °C(lit.) |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.17800 |
| Flash Point | 189.3ºC |
| Exact Mass | 217.03800 |
| PSA | 76.03000 |
| LogP | 3.19050 |
| Vapour Pressure | 2.84E-06mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | QBYRUURYXPVDAK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932190090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Ruthenium (II)-Catalyzed Transfer Hydrogenation of Aromatic and Heteroaromatic Aldehydes in Air. Bhosale SS and Singh KS.
Synth. Commun. 45(12) , 1-10, (2015)
|
|
|
New di-and triorganotin (IV) carboxylates derived from a Schiff base: synthesis, characterization and in vitro antimicrobial activities. Dias LC, et al.
Appl. Organomet. Chem. 29(5) , 305-313, (2015)
|
| MFCD00216586 |
| 5-(2-Nitrophenyl)furfural |