n-(9-fluorenylmethoxycarbonyl)-l-leucin& structure
|
Common Name | n-(9-fluorenylmethoxycarbonyl)-l-leucin& | ||
|---|---|---|---|---|
| CAS Number | 200937-57-1 | Molecular Weight | 354.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H2315NO4 | Melting Point | 152-156ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of n-(9-fluorenylmethoxycarbonyl)-l-leucin&Fmoc-leucine-15N is a 15N-labeled and 13C-labled EIDD-1931. EIDD-1931 (Beta-d-N4-hydroxycytidine; NHC) is a novel nucleoside analog and behaves as a potent anti-virus agent. EIDD-1931 effectively inhibits the replication activity of venezuelan equine ence |
| Name | N-(9-Fluorenylmethoxycarbonyl)-L-leucine-15N |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-leucine-15N is a 15N-labeled and 13C-labled EIDD-1931. EIDD-1931 (Beta-d-N4-hydroxycytidine; NHC) is a novel nucleoside analog and behaves as a potent anti-virus agent. EIDD-1931 effectively inhibits the replication activity of venezuelan equine ence |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[75]. |
| References |
| Melting Point | 152-156ºC(lit.) |
|---|---|
| Molecular Formula | C21H2315NO4 |
| Molecular Weight | 354.41 |
| Exact Mass | 354.16000 |
| PSA | 75.63000 |
| LogP | 4.41530 |
| InChIKey | CBPJQFCAFFNICX-VIKCBUFNSA-N |
| SMILES | CC(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| L-Leucine-15N,N-Fmoc |
| Fmoc-Leu-OH-15N |
| MFCD00209748 |