Fmoc-D-Lys-OH.HCl structure
|
Common Name | Fmoc-D-Lys-OH.HCl | ||
|---|---|---|---|---|
| CAS Number | 201002-47-3 | Molecular Weight | 404.887 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-D-Lys-OH.HClFmoc-D-Lys-OH.HCl is a lysine derivative[1]. |
| Name | fmoc-d-lys-oh hcl |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-D-Lys-OH.HCl is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C21H25ClN2O4 |
|---|---|
| Molecular Weight | 404.887 |
| Exact Mass | 404.150299 |
| PSA | 101.65000 |
| LogP | 5.00050 |
| Index of Refraction | 11 ° (C=1, DMF) |
| InChIKey | MVMZFAIUUXYFGY-FSRHSHDFSA-N |
| SMILES | Cl.NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Storage condition | 0-10°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-aminohexanoic acid hydrochloride |
| FMoc-D-Lys.Hcl |
| Nα-Fmoc-D-lysine Hydrochloride |
| Fmoc-Lys-OH hydrochloride |
| Fmoc-Lys-OH��HCl |
| N2-Fmoc-D-lysine HCl |
| D-Lysine,N2-[(9H-fluoren-9-ylMethoxy)carbonyl]-,Monohydrochloride |
| Lysine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, hydrochloride (1:1) |
| FMoc-D-Lys-OH hydrochloride |
| Nalpha-Fmoc-D-lysine Hydrochloride |
| FMOC-D-LYSINE HYDROCHLORIDE |
| D-Lysine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, hydrochloride (1:1) |
| Nalpha-Fmoc-D-lysine HydrochlorideFmoc-D-Lys-OH.HCl |
| Fmoc-Lys(NH3+Cl-) |
| Nalpha-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-lysine Hydrochloride |
| FMOC-D-LYSINE HCL |
| Nα-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-lysine Hydrochloride |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]lysine hydrochloride (1:1) |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-lysine hydrochloride (1:1) |
| Fmoc-D-Lys-OH.HCl |