Phthalic acid, 4-methyl-, dimethyl ester (8CI) structure
|
Common Name | Phthalic acid, 4-methyl-, dimethyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 20116-65-8 | Molecular Weight | 208.21100 | |
| Density | 1.147g/cm3 | Boiling Point | 269.5ºC at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6ºC | |
| Name | dimethyl 4-methylbenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 269.5ºC at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 127.6ºC |
| Exact Mass | 208.07400 |
| PSA | 52.60000 |
| LogP | 1.56820 |
| Vapour Pressure | 0.00724mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | GICLKLDOSTVQQA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C)cc1C(=O)OC |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,4-methyl-,dimethyl ester |
| 1,2-Benzenedicarboxylic acid,4-methyl-,dimethyl ester |
| 3,4-dimethoxycarbonyltoluene |
| 1,2-[(4-methyl)pnenyl]dicarboxylic acid dimethyl ester |
| Dimethyl 4-methyl-1,2-benzenedicarboxylate |
| dimethyl-4-methylphthalate |
| 4-methyl phthalic acid dimethyl ester |
| 4-methyl dimethyl phthalate |
| Phthalic acid,4-methyl-,dimethyl ester (8CI) |