[(dimethylamino)methylene]dimethylammonium methyl sulphate structure
|
Common Name | [(dimethylamino)methylene]dimethylammonium methyl sulphate | ||
|---|---|---|---|---|
| CAS Number | 2013-91-4 | Molecular Weight | 212.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethylaminomethylidene(dimethyl)azanium,methyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H16N2O4S |
|---|---|
| Molecular Weight | 212.26700 |
| Exact Mass | 212.08300 |
| PSA | 81.06000 |
| LogP | 0.02220 |
| InChIKey | AOOJBRIQPYLGMR-UHFFFAOYSA-M |
| SMILES | CN(C)C=[N+](C)C.COS(=O)(=O)[O-] |
| HS Code | 2923900090 |
|---|
|
~%
[(dimethylamino... CAS#:2013-91-4 |
| Literature: NOVARTIS AG Patent: WO2009/90251 A2, 2009 ; Location in patent: Page/Page column 135 ; |
|
~%
[(dimethylamino... CAS#:2013-91-4 |
| Literature: Wasserman, Harry H.; Ives, Jeffrey L. Journal of Organic Chemistry, 1985 , vol. 50, # 19 p. 3573 - 3580 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| [(dimethylamino)methylene]dimethylammonium methyl sulphate |
| Tetramethylformamidinium-methylsulfate |
| tetramethylformamidinium methylsulphate |
| N,N,N',N'-Tetramethylformamidiniummethylsulfate |
| N,N,N',N'-tetramethylformamidinium methylsulfate |