3-Chloro-4-[(3-fluorobenzyl)oxy]aniline structure
|
Common Name | 3-Chloro-4-[(3-fluorobenzyl)oxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 202197-26-0 | Molecular Weight | 251.684 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 387.9±32.0 °C at 760 mmHg | |
| Molecular Formula | C13H11ClFNO | Melting Point | 78.0 to 82.0 °C | |
| MSDS | N/A | Flash Point | 188.4±25.1 °C | |
| Name | 3-chloro-4-[(3-fluorophenyl)methoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.9±32.0 °C at 760 mmHg |
| Melting Point | 78.0 to 82.0 °C |
| Molecular Formula | C13H11ClFNO |
| Molecular Weight | 251.684 |
| Flash Point | 188.4±25.1 °C |
| Exact Mass | 251.051315 |
| PSA | 35.25000 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | AYPFEYDGZDPAPE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OCc2cccc(F)c2)c(Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | 3077 |
| Packaging Group | III |
| HS Code | 2922299090 |
|
~99%
3-Chloro-4-[(3-... CAS#:202197-26-0 |
| Literature: Lackey, Karen Elizabeth; Spector, Neil; Wood lll, Edgar Raymond; Xia, Wenle Patent: US2004/53946 A1, 2004 ; |
|
~92%
3-Chloro-4-[(3-... CAS#:202197-26-0 |
| Literature: BAYER HEALTHCARE AG Patent: US2010/298297 A1, 2010 ; Location in patent: Page/Page column 14 ; |
|
~%
3-Chloro-4-[(3-... CAS#:202197-26-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 17 p. 4686 - 4691 |
|
~%
3-Chloro-4-[(3-... CAS#:202197-26-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 17 p. 4686 - 4691 |
|
~%
3-Chloro-4-[(3-... CAS#:202197-26-0 |
| Literature: WO2011/2523 A1, ; WO 2011/002523 A1 |
|
~%
3-Chloro-4-[(3-... CAS#:202197-26-0 |
| Literature: WO2011/2523 A1, ; WO 2011/002523 A1 |
| Precursor 6 | |
|---|---|
| DownStream 8 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-chloro-4-(3-fluoro-benzyloxy)-phenylamine |
| 3-chloro-4-{[(3-fluorophenyl)methyl]oxy}aniline |
| ZR CG DO1R CF |
| 3-Chloro-4-(3-fluorobenzyloxy)aniline |
| 3-Chloro-4-[(3-fluorobenzyl)oxy]aniline |
| 3-chloro-4-((3-fluorobenzyl)oxy)aniline |
| 4-(3-fluorobenzyloxy)-3-chlorobenzenamine |
| 3-Chloro-4-[(3-fluorophenyl)methoxy]benzenamine |
| Benzenamine, 3-chloro-4-[(3-fluorophenyl)methoxy]- |