4-chloro-3-nitrobenzyl alcohol structure
|
Common Name | 4-chloro-3-nitrobenzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 55912-20-4 | Molecular Weight | 187.58000 | |
| Density | 1.476g/cm3 | Boiling Point | 347.6ºC at 760mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | 62-64 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 164ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 4-chloro-3-nitrobenzyl alcohol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.476g/cm3 |
|---|---|
| Boiling Point | 347.6ºC at 760mmHg |
| Melting Point | 62-64 °C(lit.) |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58000 |
| Flash Point | 164ºC |
| Exact Mass | 187.00400 |
| PSA | 66.05000 |
| LogP | 2.26370 |
| InChIKey | QLLRQJDSYJIXTN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(CO)ccc1Cl |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335-H411 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2906299090 |
|
~96%
4-chloro-3-nitr... CAS#:55912-20-4 |
| Literature: Actelion Pharmaceuticals Ltd. Patent: US2009/275588 A1, 2009 ; Location in patent: Page/Page column 10 ; |
|
~98%
4-chloro-3-nitr... CAS#:55912-20-4 |
| Literature: Marchand, Pascal; Antoine, Maud; Baut, Guillaume Le; Czech, Michael; Baasner, Silke; Guenther, Eckhard Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 18 p. 6715 - 6727 |
|
~%
4-chloro-3-nitr... CAS#:55912-20-4 |
| Literature: Journal of the American Chemical Society, , vol. 81, p. 4328,4330,4333 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Stability studies of C-4',6' acetal benzylmaltosides synthesized as inhibitors of smooth muscle cell proliferation.
Bioorg. Med. Chem. Lett. 14(11) , 2829-33, (2004) In our investigations to synthesize inhibitors of smooth muscle cell (SMC) proliferation, compound 6a displayed submicromolar activity in in vitro antiproliferative assays and reduced intimal thickeni... |
|
|
A New Efficient Synthetic Method for 3-Iodothyronamine and Its Potent Hypothermic Efficacy. Kim J-G, et al.
Chin. J. Chem. 29(10) , 2205-8, (2011)
|
| 4-chloro-3-nitro-benzyl alcohol |
| 3-Hydroxymethyl-6-chloronitrobenzene |
| RARECHEM AL BD 0170 |
| 3-Nitro-4-chlorobenzenemethanol |
| 3-Nitro-4-chlorobenzyl alcohol |
| alcool chloro-4 nitro-3 benzylique |
| 4-chloro-3-nitrobenzyl alchohol |
| MFCD00007086 |
| 1-Chloro-4-hydroxymethyl-2-nitrobenzene |
| (4-chloro-3-nitrophenyl)-methanol |
| EINECS 259-901-4 |