4-Benzyloxyindole structure
|
Common Name | 4-Benzyloxyindole | ||
|---|---|---|---|---|
| CAS Number | 20289-26-3 | Molecular Weight | 223.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 411.6±20.0 °C at 760 mmHg | |
| Molecular Formula | C15H13NO | Melting Point | 57-61 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 148.9±12.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Benzyloxyindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.6±20.0 °C at 760 mmHg |
| Melting Point | 57-61 °C(lit.) |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.270 |
| Flash Point | 148.9±12.0 °C |
| Exact Mass | 223.099716 |
| PSA | 25.02000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | LJFVSIDBFJPKLD-UHFFFAOYSA-N |
| SMILES | c1ccc(COc2cccc3[nH]ccc23)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Synthesis, pharmacology, and molecular modeling of novel 4-alkyloxy indole derivatives related to cannabimimetic aminoalkyl indoles (AAIs).
Bioorg. Med. Chem. 5(8) , 1591-600, (1997) Several novel 4-alkyloxy-aminoalkyl indole derivatives 3 were synthesized from 4-benzyloxyindole (1). Alkylation of 1 with 4-(2-chloroethyl)morpholine (NaH/HMPA) formed 2. Deprotection using palladium... |
| EINECS 243-690-0 |
| 4-(Benzyloxy)-1H-indole |
| 4-Benzyloxy-indol |
| 4-BENZYLOXYLINDOLE |
| 4-Benzyloxyindole |
| 1H-Indole, 4-(phenylmethoxy)- |
| MFCD00047200 |
| 4-BENZYLOXY-1H-INDOLE |