thiometon-sulfone structure
|
Common Name | thiometon-sulfone | ||
|---|---|---|---|---|
| CAS Number | 20301-63-7 | Molecular Weight | 278.35000 | |
| Density | 1.342g/cm3 | Boiling Point | 399.9ºC at 760 mmHg | |
| Molecular Formula | C6H15O4PS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.6ºC | |
| Name | 2-ethylsulfonylethylsulfanyl-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 399.9ºC at 760 mmHg |
| Molecular Formula | C6H15O4PS3 |
| Molecular Weight | 278.35000 |
| Flash Point | 195.6ºC |
| Exact Mass | 277.98700 |
| PSA | 128.18000 |
| LogP | 3.40300 |
| Vapour Pressure | 3.06E-06mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | GAXMYYJSILFZLT-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)CCSP(=S)(OC)OC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| thiometon-sulfone |
| Thioometon sulfone |
| 2-ethylsulfonylethylsulfanyl-dimethoxy-sulfanylidene |